CAS 40027-88-1

1-[4-(methylsulfanyl)phenyl]-3-phenylpropan-1-one

Description:

1-[4-(Methylsulfanyl)phenyl]-3-phenylpropan-1-one, also known by its CAS number 40027-88-1, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two phenyl groups and a methylthio substituent, which contributes to its unique chemical properties. The presence of the methylsulfanyl group enhances its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high lipophilicity, making them suitable for various applications in organic synthesis and medicinal chemistry. The compound may also display interesting biological activities due to its structural features, which can influence interactions with biological targets. Its synthesis often involves multi-step organic reactions, and it may be utilized in the development of pharmaceuticals or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₆H₁₆OS

InChI: InChI=1/C16H16OS/c1-18-15-10-8-14(9-11-15)16(17)12-7-13-5-3-2-4-6-13/h2-6,8-11H,7,12H2,1H3

SMILES: CSc1ccc(cc1)C(=O)CCc1ccccc1

3-phenyl-4′-thiomethylpropiophenone

CAS: 40027-88-1

Formula: C₁₆H₁₆OS

Purity: 97.0%

Molecular weight: 256.36

Ref: 10-F205579