CAS 40029-37-6

2-Propenamide, 2-cyano-3-(4-pyridinyl)-, (E)-

Description:

2-Propenamide, 2-cyano-3-(4-pyridinyl)-, (E)-, also known by its CAS number 40029-37-6, is an organic compound characterized by its amide functional group and a cyano group attached to a propenamide backbone. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The (E)- configuration indicates that the substituents around the double bond are on opposite sides, influencing its reactivity and interaction with biological systems. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of both the amide and cyano groups, which can engage in hydrogen bonding and dipole-dipole interactions. This structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and solubility can vary based on environmental conditions, such as pH and temperature, which are crucial for its applications in research and industry. Overall, 2-Propenamide, 2-cyano-3-(4-pyridinyl)-, (E)- is a versatile compound with potential uses in various chemical and pharmaceutical contexts.

Formula: C₉H₇N₃O

InChI: InChI=1S/C9H7N3O/c10-6-8(9(11)13)5-7-1-3-12-4-2-7/h1-5H,(H2,11,13)/b8-5+

InChI key: InChIKey=OJUGYMUOPZHNKD-VMPITWQZSA-N

SMILES: C(=C(/C(N)=O)\C#N)\C=1C=CN=CC1

Synonyms:

• 2-Propenamide, 2-cyano-3-(4-pyridinyl)-, (E)-

2-Cyano-3-(4-pyridinyl)acrylamide

CAS: 40029-37-6

Versatile small molecule scaffold

Formula: C₉H₇N₃O

Purity: Min. 95%

Molecular weight: 173.17 g/mol

Ref: 3D-QBA02937