CAS 40032-76-6

2-Bromo-3-bromomethylthiophene

Description:

2-Bromo-3-bromomethylthiophene is a heterocyclic organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic ring containing sulfur. The compound features two bromine substituents: one at the 2-position and another at the 3-bromomethyl position of the thiophene ring. This substitution pattern can influence its reactivity and physical properties, such as solubility and boiling point. The presence of bromine atoms typically enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the thiophene moiety contributes to the compound's aromatic stability and potential applications in organic electronics and materials science. The compound's CAS number, 40032-76-6, allows for its identification in chemical databases and literature. Overall, 2-Bromo-3-bromomethylthiophene is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules.

Formula: C₅H₄Br₂S

InChI: InChI=1/C5H4Br2S/c6-3-4-1-2-8-5(4)7/h1-2H,3H2

SMILES: c1csc(c1CBr)Br

Synonyms:

• 2-Bromo-3-(bromomethyl)thiophene

2-Bromo-3-(bromomethyl)thiophene

CAS: 40032-76-6

Formula: C₅H₄Br₂S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 255.9583

Ref: IN-DA003GMH

2-Bromo-3-(bromomethyl)thiophene

CAS: 40032-76-6

2-Bromo-3-(bromomethyl)thiophene

Purity: 97%

Color and Shape: Liquid

Molecular weight: 255.96g/mol

Ref: 54-OR8035

2-Bromo-3-bromomethylthiophene

CAS: 40032-76-6

Formula: C₅H₄Br₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.96

Ref: 10-F036973