
CAS 40034-60-4
:2,6-Dimethyl-4-(3-nitrophenyl)pyridine
Description:
2,6-Dimethyl-4-(3-nitrophenyl)pyridine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two methyl groups at the 2 and 6 positions of the pyridine ring, contributing to its hydrophobic character and influencing its solubility in organic solvents. The presence of a nitrophenyl group at the 4-position introduces electron-withdrawing characteristics, which can affect the compound's reactivity and interaction with other chemical species. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and material science. The molecular structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as nitro-substituted compounds can sometimes pose hazards.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-9-6-12(7-10(2)14-9)11-4-3-5-13(8-11)15(16)17/h3-8H,1-2H3
InChI key:InChIKey=FTWIJYIVFAWSLZ-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(C)=N1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- 2,6-Dimethyl-4-(3-nitrophenyl)pyridine
- Pyridine, 2,6-dimethyl-4-(3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
