CAS 40039-49-4: 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-chromen-3-yl beta-D-glucopyranoside
Description:5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-chromen-3-yl beta-D-glucopyranoside, with the CAS number 40039-49-4, is a flavonoid glycoside characterized by its complex structure, which includes a chromenone core and a glucose moiety. This compound exhibits antioxidant properties, attributed to the presence of multiple hydroxyl groups that can scavenge free radicals. It is soluble in polar solvents, which enhances its bioavailability and potential therapeutic applications. The methoxy groups on the phenyl ring contribute to its stability and may influence its interaction with biological targets. Additionally, this compound may exhibit various biological activities, including anti-inflammatory and anticancer effects, making it of interest in pharmacological research. Its structural features suggest potential for further studies in natural product chemistry and medicinal applications, particularly in the development of nutraceuticals or pharmaceuticals aimed at oxidative stress-related conditions.
Formula:C23H24O13
InChI:InChI=1/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
- Synonyms:
- Syringetin-3-glucoside