CAS 4004-97-1
:1-(4-fluorophenyl)-4-(p-tolylsulphonyl)piperazine
Description:
1-(4-Fluorophenyl)-4-(p-tolylsulphonyl)piperazine, identified by its CAS number 4004-97-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, contributing to its electronic properties and potential biological activity. Additionally, the p-tolylsulphonyl group suggests the presence of a sulfonyl functional group attached to a para-substituted toluene, which can enhance the compound's solubility and reactivity. The overall structure of this compound may impart specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its characteristics, including solubility, stability, and reactivity, can be influenced by the functional groups present, which may also affect its interactions with biological targets.
Formula:C17H19FN2O2S
InChI:InChI=1/C17H19FN2O2S/c1-14-2-8-17(9-3-14)23(21,22)20-12-10-19(11-13-20)16-6-4-15(18)5-7-16/h2-9H,10-13H2,1H3
InChI key:InChIKey=CIGSCDLAXLXDQV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCN(CC1)C2=CC=C(F)C=C2)C3=CC=C(C)C=C3
Synonyms:- 1-(4-Fluoro-phenyl)-4-(toluene-4-sulfonyl)-piperazine
- 1-(4-Fluorophenyl)-4-(p-tolylsulfonyl)piperazine
- 1-(4-Fluorophenyl)-4-[(4-Methylphenyl)Sulfonyl]Piperazine
- 1-(4-Fluorophenyl)-4-tosylpiperazine
- Piperazine, 1-(4-fluorophenyl)-4-[(4-methylphenyl)sulfonyl]-
- Piperazine, 1-(p-fluorophenyl)-4-(p-tolylsulfonyl)-
- 1-(4-Fluorophenyl)-4-(p-tolylsulphonyl)piperazine
- Einecs 223-656-1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery