CAS 40047-23-2

6-Hydroxy-1H-indole-2-carboxylic acid

Description:

6-Hydroxy-1H-indole-2-carboxylic acid, also known as 6-hydroxyindole-2-carboxylic acid, is an organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. This compound contains a hydroxyl group (-OH) at the 6-position and a carboxylic acid group (-COOH) at the 2-position of the indole ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl and carboxylic acid functional groups. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities, including antioxidant properties and its role as a precursor in the synthesis of other indole derivatives. Its CAS number, 40047-23-2, is a unique identifier that facilitates the identification and study of this specific chemical substance in scientific literature and databases.

Formula: C₉H₇NO₃

InChI: InChI=1S/C9H7NO3/c11-6-2-1-5-3-8(9(12)13)10-7(5)4-6/h1-4,10-11H,(H,12,13)

InChI key: InChIKey=HJUFFOMJRAXIRF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=2C(N1)=CC(O)=CC2

Synonyms:

• 1H-Indole-2-carboxylic acid, 6-hydroxy-
• 6-Hydroxy-1H-indole-2-carboxylic acid
• 6-Hydroxyindole-2-carboxylic acid

6-Hydroxyindole-2-carboxylic acid

CAS: 40047-23-2

Formula: C₉H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.1568

Ref: IN-DA0075UY

6-Hydroxyindole-2-carboxylic acid

CAS: 40047-23-2

6-Hydroxyindole-2-carboxylic acid

Purity: 97%

Molecular weight: 177.16g/mol

Ref: 54-OR91734

6-Hydroxyindole-2-carboxylic acid

CAS: 40047-23-2

Formula: C₉H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.159

Ref: 10-F040324

6-Hydroxyindole-2-carboxylic Acid

Controlled Product

CAS: 40047-23-2

Applications 6-Hydroxyindole-2-carboxylic acid (cas# 40047-23-2) is a useful research chemical.

Formula: C₉H₇NO₃

Color and Shape: Neat

Molecular weight: 177.15

Ref: TR-H953825