CAS 4005-35-0

3-deoxy-D-xylo-hexitol

Description:

3-Deoxy-D-xylo-hexitol, also known as a sugar alcohol, is a carbohydrate derivative characterized by the absence of an oxygen atom in its hexose structure, specifically at the C-3 position. This compound is a stereoisomer of other hexitols and is notable for its role in various biochemical pathways, particularly in the metabolism of certain microorganisms. It typically appears as a white crystalline solid and is soluble in water, which is a common trait among sugar alcohols. The molecular structure features multiple hydroxyl (-OH) groups, contributing to its hydrophilicity and potential as a sweetener or humectant in food applications. Additionally, 3-deoxy-D-xylo-hexitol may exhibit low caloric value and is often studied for its potential health benefits, including its impact on blood sugar levels. Its CAS number, 4005-35-0, is a unique identifier that facilitates the tracking and regulation of this compound in scientific literature and industrial applications.

Formula: C₆H₁₄O₅

InChI: InChI=1/C6H14O5/c7-2-4(9)1-5(10)6(11)3-8/h4-11H,1-3H2/t4-,5-,6-/m1/s1

SMILES: C([C@H](CO)O)[C@H]([C@@H](CO)O)O

3-Deoxy-D-galactopyranose

CAS: 4005-35-0

3-Deoxy-D-galactopyranose

Formula: C₆H₁₂O₅

Purity: Tlc dcm-meoh 2:1 (Typical Value in Batch COA)

Molecular weight: 164.16g/mol

Ref: 54-BICL2189

3-Deoxy-D-galactopyranose

CAS: 4005-35-0

Ref: 7W-GC5428

3-Deoxy-D-Galactopyranose

CAS: 4005-35-0

Formula: C₆H₁₂O₅

Molecular weight: 164.16

Ref: 4Z-G-169004

3-Deoxy-D-galactopyranose

CAS: 4005-35-0

3-Deoxy-D-galactopyranose is a galectin that has been synthetically produced. It has shown to be an antagonist of galactoside, which may be useful in the treatment of type 2 diabetes. The synthetic method for this molecule is still being developed.

Formula: C₆H₁₂O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 164.16 g/mol

Ref: 3D-MD06264