CAS 4006-50-2
:1,2,3,4,6,7,8,9-octahydrophenazine
Description:
1,2,3,4,6,7,8,9-Octahydrophenazine is a bicyclic organic compound characterized by its saturated structure derived from phenazine, where all the double bonds have been hydrogenated. This results in a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is known for its relatively high stability and low reactivity compared to its unsaturated counterparts. It has a molecular formula that reflects its hydrogenated nature, contributing to its physical properties such as a moderate boiling point and melting point. Octahydrophenazine is often used in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Its solubility in organic solvents makes it useful in various applications, including pharmaceuticals and materials science. Additionally, it may exhibit interesting electronic properties due to its aromatic origins, although its saturated nature limits its conjugation. Safety data indicates that, like many organic compounds, it should be handled with care to avoid potential health hazards.
Formula:C12H16N2
InChI:InChI=1/C12H16N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H2
InChI key:InChIKey=JYYRTWNCBVRKMN-UHFFFAOYSA-N
SMILES:C=12C(=NC3=C(N1)CCCC3)CCCC2
Synonyms:- Polycartine B
- NSC 19848
- 1,2,3,4,6,7,8,9-Octahydrophenazine
- Phenazine, 1,2,3,4,6,7,8,9-octahydro-
- Aminocaproic Acid Impurity 4
- Aminocaproic Acid Impurity 4Q: What is
- Dicyclohexanopyrazine
- Nsc19848
- Aminocaproic Acid Impurity 4 Q: What is the CAS Number of
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,3,4,6,7,8,9-Octahydrophenazine
CAS:Formula:C12H16N2Purity:98%Color and Shape:SolidMolecular weight:188.26881,2,3,4,6,7,8,9-Octahydrophenazine
CAS:1,2,3,4,6,7,8,9-OctahydrophenazinePurity:98%Molecular weight:188.27g/mol1,2,3,4,6,7,8,9-Octahydrophenazine
CAS:Controlled ProductFormula:C12H16N2Color and Shape:NeatMolecular weight:188.2691,2,3,4,6,7,8,9-Octahydrophenazine
CAS:1,2,3,4,6,7,8,9-Octahydrophenazine is a cyclic ether that is usually obtained by the hydrogenation of diethylene. It is used as a pharmaceutical intermediate. 1,2,3,4,6,7,8,9-Octahydrophenazine has been shown to coordinate with metal ions such as copper and copper chromite. This coordination stabilizes the molecule and prevents decomposition. 1,2,3,4-Octahydrophenazine also has anti-inflammatory properties due to its ability to inhibit prostaglandin synthesis by inhibiting enzyme activity in the cyclooxygenase pathway.
Formula:C12H16N2Purity:Min. 95%Molecular weight:188.27 g/mol





