CAS 40070-06-2
:4,6-diaminopyrimidine-2-sulfinic acid
Description:
4,6-Diaminopyrimidine-2-sulfinic acid is an organic compound characterized by its pyrimidine ring structure, which features two amino groups at the 4 and 6 positions and a sulfinic acid group at the 2 position. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the sulfinic acid functional group, which enhances its polarity. It is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of multiple amino groups makes it a versatile building block in organic synthesis, allowing for further functionalization and derivatization. Additionally, its sulfinic acid moiety can participate in redox reactions, contributing to its reactivity. The compound is of interest in medicinal chemistry for its potential biological activities, although specific applications may vary. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H6N4O2S
InChI:InChI=1/C4H6N4O2S/c5-2-1-3(6)8-4(7-2)11(9)10/h1H,(H,9,10)(H4,5,6,7,8)
SMILES:c1c(N)nc([nH]c1=N)S(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.