CAS 40073-37-8

3-Bromo-4-isoquinolinamine

Description:

3-Bromo-4-isoquinolinamine is an organic compound characterized by its isoquinoline structure, which is a bicyclic compound containing a fused benzene and pyridine ring. The presence of a bromine atom at the 3-position and an amino group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the amino group may impart basic properties, allowing it to participate in acid-base reactions. 3-Bromo-4-isoquinolinamine may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity can vary based on the context of its use in research or industrial processes.

Formula: C₉H₇BrN₂

InChI: InChI=1S/C9H7BrN2/c10-9-8(11)7-4-2-1-3-6(7)5-12-9/h1-5H,11H2

InChI key: InChIKey=DERRKDMURMTHHF-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=NC1Br)C=CC=C2

Synonyms:

• 3-Bromo-4-isoquinolinamine
• 4-Amino-3-bromoisoquinoline
• 4-Isoquinolinamine, 3-Bromo-
• T66 Cnj De Ez
• 3-Bromoisoquinolin-4-amine

4-Isoquinolinamine,3-bromo-(9CI)

CAS: 40073-37-8

Formula: C₉H₇BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 223.0693

Ref: IN-DA00CZ2R

3-Bromoisoquinolin-4-amine

CAS: 40073-37-8

3-Bromoisoquinolin-4-amine

Purity: 95%

Color and Shape: Solid

Molecular weight: 223.07g/mol

Ref: 54-OR72166

4-Amino-3-bromoisoquinoline

CAS: 40073-37-8

Formula: C₉H₇BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 223.073

Ref: 10-F076389

4-Amino-3-bromoisoquinoline

CAS: 40073-37-8

4-Amino-3-bromoisoquinoline is an isocyanide that reacts with nucleophilic heteroatoms such as the amino group. It also reacts with bromine to form a bromopyridine. The nitrile group of 4-amino-3-bromoisoquinoline can be reduced with sodium borohydride to produce 4-aminoquinoline. This compound has shown potential for use in chemotherapy and treating bacterial infections.

Purity: Min. 95%

Ref: 3D-FA42189