CAS 40073-45-8

1,2a,3,7b-tetrahydro-2H-indeno[1,2-b]azet-2-one

Description:

1,2a,3,7b-tetrahydro-2H-indeno[1,2-b]azet-2-one is a bicyclic compound characterized by its unique fused ring structure, which includes an indene and azetidine moiety. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its potential biological activity. It is generally a solid at room temperature and may have specific solubility characteristics depending on the solvent used. The presence of the carbonyl group (ketone) in its structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the stereochemistry of the compound can influence its reactivity and interactions with biological targets. While specific applications may vary, compounds of this type are often explored in medicinal chemistry for their potential therapeutic effects. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or reactivity.

Formula: C₁₀H₉NO

InChI: InChI=1/C10H9NO/c12-10-8-5-6-3-1-2-4-7(6)9(8)11-10/h1-4,8-9H,5H2,(H,11,12)

SMILES: c1ccc2c(c1)CC1C2N=C1O

3,4-Benzo-cis-6-azabicyclo[3.2.0]heptane-7-one

CAS: 40073-45-8

3,4-Benzo-cis-6-azabicyclo[3.2.0]heptane-7-one

Purity: ≥95%

Molecular weight: 159.18g/mol

Ref: 54-OR307534