CAS 400745-54-2

2'-methylbiphenyl-3-amine

Description:

2'-Methylbiphenyl-3-amine, identified by its CAS number 400745-54-2, is an organic compound characterized by the presence of an amine functional group attached to a biphenyl structure with a methyl substituent. This compound features two phenyl rings connected by a single bond, with a methyl group located at the 2' position of one ring and an amino group at the 3 position of the other. The presence of the amino group imparts basic properties to the molecule, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The methyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the structural arrangement can affect its electronic properties and reactivity, making it of interest in fields such as organic synthesis and materials science. Overall, 2'-methylbiphenyl-3-amine is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis.

Formula: C₁₃H₁₃N

InChI: InChI=1/C13H13N/c1-10-5-2-3-8-13(10)11-6-4-7-12(14)9-11/h2-9H,14H2,1H3

SMILES: Cc1ccccc1c1cccc(c1)N

Synonyms:

• [1,1'-Biphenyl]-3-amine, 2'-methyl-
• 2'-Methylbiphenyl-3-amine

2'-Methyl-[1,1'-biphenyl]-3-amine

CAS: 400745-54-2

Formula: C₁₃H₁₃N

Purity: 97%

Molecular weight: 183.2490

Ref: IN-DA003IUB

2'-Methyl [1,1'-biphenyl]-3-amine

CAS: 400745-54-2

2'-Methyl [1,1'-biphenyl]-3-amine

Purity: ≥95%

Molecular weight: 183.25g/mol

Ref: 54-OR7493

2′-Methylbiphenyl-3-ylamine

CAS: 400745-54-2

Formula: C₁₃H₁₃N

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 183.254

Ref: 10-F014338