CAS 400755-43-3

1-Ethyl-1H-pyrazole-5-carboxylic acid

Description:

1-Ethyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group attached to one nitrogen atom and a carboxylic acid functional group (-COOH) at the 5-position of the pyrazole ring. Its molecular formula typically reflects the presence of carbon, hydrogen, and nitrogen atoms, along with the carboxylic acid group contributing to its acidic properties. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid, which can engage in hydrogen bonding. Additionally, 1-Ethyl-1H-pyrazole-5-carboxylic acid may possess biological activity, making it of interest in pharmaceutical research and development. Its unique structure allows for potential applications in various fields, including agrochemicals and medicinal chemistry, where pyrazole derivatives are often explored for their diverse biological activities.

Formula: C₆H₈N₂O₂

InChI: InChI=1S/C6H8N2O2/c1-2-8-5(6(9)10)3-4-7-8/h3-4H,2H2,1H3,(H,9,10)

InChI key: InChIKey=FSMHDKRQCDWWGZ-UHFFFAOYSA-N

SMILES: C(C)N1C(C(O)=O)=CC=N1

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 1-ethyl-
• 2-Ethylpyrazole-3-carboxylic acid
• 1-Ethyl-1H-pyrazole-5-carboxylic acid

1-Ethylpyrazole-5-carboxylic Acid

CAS: 400755-43-3

Formula: C₆H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA0032RC

1-Ethyl-1H-pyrazole-5-carboxylic acid

CAS: 400755-43-3

1-Ethyl-1H-pyrazole-5-carboxylic acid

Purity: 99%

Molecular weight: 140.14g/mol

Ref: 54-OR950986

1-Ethyl-1H-pyrazole-5-carboxylic acid

CAS: 400755-43-3

Formula: C₆H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 140.142

Ref: 10-F014531