CAS 400757-07-5

3,5-Dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine

Description:

3,5-Dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 3 and 5 positions of the pyrazole ring, contributing to its hydrophobic character and potentially influencing its biological activity. The presence of a 2-methylphenyl group at the 1-position enhances its lipophilicity and may affect its interaction with biological targets. The methanamine functional group at the 4-position introduces basicity, allowing for potential interactions with acidic sites in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many organic compounds, its solubility, stability, and reactivity will depend on environmental conditions such as pH and temperature. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₃H₁₇N₃

InChI: InChI=1S/C13H17N3/c1-9-6-4-5-7-13(9)16-11(3)12(8-14)10(2)15-16/h4-7H,8,14H2,1-3H3

InChI key: InChIKey=KLVWCBVJLFOUFB-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C)C1CN)C2=C(C)C=CC=C2

Synonyms:

• 1H-Pyrazole-4-methanamine, 3,5-dimethyl-1-(2-methylphenyl)-
• 3,5-Dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine

[3,5-Dimethyl-1-(2-methylphenyl)-1H-pyrazol-4-yl]methanamine

CAS: 400757-07-5

Versatile small molecule scaffold

Formula: C₁₃H₁₇N₃

Purity: Min. 95%

Molecular weight: 215.29 g/mol

Ref: 3D-ARA75707