CAS 400757-13-3

N,3,5-Trimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine

Description:

N,3,5-Trimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine, with the CAS number 400757-13-3, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features multiple methyl groups, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The presence of the 2-methylphenyl substituent suggests that it may exhibit aromatic properties, which can affect its interactions with other molecules. The amine functional group indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may be of interest in pharmaceutical research due to its structural features, which could be linked to specific biological activities or mechanisms of action. Its synthesis and reactivity would be influenced by the presence of the various functional groups, making it a candidate for further investigation in medicinal chemistry or related fields. As with any chemical substance, safety and handling precautions should be observed, given the potential for biological activity.

Formula: C₁₄H₁₉N₃

InChI: InChI=1S/C14H19N3/c1-10-7-5-6-8-14(10)17-12(3)13(9-15-4)11(2)16-17/h5-8,15H,9H2,1-4H3

InChI key: InChIKey=GSGOAIWYGOWBKD-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C)C1CNC)C2=C(C)C=CC=C2

Synonyms:

• N,3,5-Trimethyl-1-(2-methylphenyl)-1H-pyrazole-4-methanamine
• 1H-Pyrazole-4-methanamine, N,3,5-trimethyl-1-(2-methylphenyl)-

{[3,5-Dimethyl-1-(2-methylphenyl)-1H-pyrazol-4-yl]methyl}(methyl)amine

CAS: 400757-13-3

Versatile small molecule scaffold

Formula: C₁₄H₁₉N₃

Purity: Min. 95%

Molecular weight: 229.32 g/mol

Ref: 3D-ARA75713