CAS 40077-57-4: Aviptadil
Description:Aviptadil, with the CAS number 40077-57-4, is a synthetic peptide that is primarily known for its role as a vasoactive intestinal peptide (VIP) analog. It exhibits a range of biological activities, including vasodilation, modulation of immune responses, and neuroprotection. Aviptadil is composed of 28 amino acids and is characterized by its ability to bind to VIP receptors, which are involved in various physiological processes, including smooth muscle relaxation and inhibition of inflammatory responses. This peptide has garnered attention for its potential therapeutic applications, particularly in respiratory conditions, as it may help in reducing inflammation and improving lung function. Additionally, Aviptadil has been investigated for its potential use in treating conditions such as erectile dysfunction and pulmonary diseases. Its stability and bioactivity make it a subject of interest in pharmacological research, although further studies are necessary to fully elucidate its mechanisms of action and therapeutic efficacy.
Formula:C147H237N43O43S
InChI:InChI=1/C147H237N43O43S/c1-18-75(12)115(142(229)180-96(56-72(6)7)131(218)183-104(145(232)233)63-110(155)200)188-139(226)106(68-192)185-134(221)101(62-109(154)199)177-130(217)95(55-71(4)5)174-132(219)97(58-81-37-41-84(195)42-38-81)175-125(212)88(33-23-26-49-149)167-123(210)89(34-24-27-50-150)171-140(227)113(73(8)9)186-118(205)76(13)164-121(208)93(47-53-234-17)170-127(214)92(45-46-107(152)197)169-122(209)87(32-22-25-48-148)166-124(211)90(35-28-51-161-146(156)157)168-129(216)94(54-70(2)3)173-126(213)91(36-29-52-162-147(158)159)172-143(230)116(78(15)193)189-136(223)98(59-82-39-43-85(196)44-40-82)176-133(220)100(61-108(153)198)178-135(222)103(65-112(203)204)182-144(231)117(79(16)194)190-137(224)99(57-80-30-20-19-21-31-80)181-141(228)114(74(10)11)187-119(206)77(14)165-128(215)102(64-111(201)202)179-138(225)105(67-191)184-120(207)86(151)60-83-66-160-69-163-83/h19-21,30-31,37-44,66,69-79,86-106,113-117,191-196H,18,22-29,32-36,45-65,67-68,148-151H2,1-17H3,(H2,152,197)(H2,153,198)(H2,154,199)(H2,155,200)(H,160,163)(H,164,208)(H,165,215)(H,166,211)(H,167,210)(H,168,216)(H,169,209)(H,170,214)(H,171,227)(H,172,230)(H,173,213)(H,174,219)(H,175,212)(H,176,220)(H,177,217)(H,178,222)(H,179,225)(H,180,229)(H,181,228)(H,182,231)(H,183,218)(H,184,207)(H,185,221)(H,186,205)(H,187,206)(H,188,226)(H,189,223)(H,190,224)(H,201,202)(H,203,204)(H,232,233)(H4,156,157,161)(H4,158,159,162)/t75-,76-,77-,78+,79+,86-,87-,88-,89-,90-,91-,92-,93-,94-,95-,96-,97-,98-,99-,100-,101-,102-,103-,104-,105-,106-,113-,114-,115-,116-,117-/m0/s1
- Synonyms:
- Aviptadil Acetate
- VIP (human, mouse, rat) acetate salt