CymitQuimica logo

CAS 400771-42-8

:

2-Methoxy-5-(trifluoromethyl)benzenemethanamine

Description:
2-Methoxy-5-(trifluoromethyl)benzenemethanamine, with the CAS number 400771-42-8, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a trifluoromethyl group attached to a benzene ring. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can also participate in hydrogen bonding and may affect the compound's solubility and stability. Overall, this compound's unique combination of functional groups suggests potential utility in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are influenced by the specific arrangement of atoms and the interactions between them.
Formula:C9H10F3NO
InChI:InChI=1S/C9H10F3NO/c1-14-8-3-2-7(9(10,11)12)4-6(8)5-13/h2-4H,5,13H2,1H3
InChI key:InChIKey=YZXMLHJVUWEAKE-UHFFFAOYSA-N
SMILES:C(N)C1=C(OC)C=CC(C(F)(F)F)=C1
Synonyms:
  • Benzenemethanamine, 2-methoxy-5-(trifluoromethyl)-
  • 2-Methoxy-5-(trifluoromethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.