CAS 400852-66-6
:Mesosulfuron
Description:
Mesosulfuron is a selective herbicide belonging to the sulfonylurea class, primarily used for controlling broadleaf weeds and certain grasses in various crops. Its chemical structure features a sulfonylurea moiety, which is responsible for its herbicidal activity by inhibiting the enzyme acetolactate synthase (ALS), crucial for amino acid synthesis in plants. Mesosulfuron is characterized by its systemic action, allowing it to be absorbed by plant foliage and roots, leading to effective weed management. It is typically applied post-emergence and is known for its low toxicity to non-target organisms, making it a preferred choice in integrated pest management systems. The substance is generally stable under normal environmental conditions but may degrade in the presence of strong acids or bases. Its solubility in water and organic solvents varies, influencing its application methods and environmental behavior. As with all agrochemicals, proper handling and adherence to safety guidelines are essential to minimize environmental impact and ensure user safety.
Formula:C16H19N5O9S2
InChI:InChI=1S/C16H19N5O9S2/c1-29-12-7-13(30-2)19-15(18-12)20-16(24)21-32(27,28)11-6-9(8-17-31(3,25)26)4-5-10(11)14(22)23/h4-7,17H,8H2,1-3H3,(H,22,23)(H2,18,19,20,21,24)
InChI key:InChIKey=MAYMYMXYWIVVOK-UHFFFAOYSA-N
SMILES:S(NC(NC=1N=C(OC)C=C(OC)N1)=O)(=O)(=O)C2=C(C(O)=O)C=CC(CNS(C)(=O)=O)=C2
Synonyms:- 2-[[[[(4,6-Dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfonyl)amino]methyl]benzoic acid
- 400852-66-6
- Ae-F 154851
- Benzoic acid, 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfonyl)amino]methyl]-
- Mesosulfuron
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mesosulfuron
CAS:Controlled Product<p>Applications Mesosulfuron is used in synergistic herbicidal combinations.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Baur, P., et al.: PCT Int. Appl. (2020), WO 2020173719 A1<br></p>Formula:C16H19N5O9S2Color and Shape:Off-WhiteMolecular weight:489.4802Mesosulfuron
CAS:<p>Mesosulfuron is a selective herbicide, which is a synthetic chemical compound with a specific mode of action designed to inhibit acetolactate synthase (ALS). This enzyme inhibition disrupts the biosynthesis of essential amino acids such as valine, leucine, and isoleucine, leading to the cessation of cell division and consequent plant growth arrest. The herbicide is primarily utilized in agricultural settings, particularly for post-emergence control of various grass weeds within cereal crops, including wheat and barley. Its application is crucial for managing weed competition that can significantly impact crop yield and quality. Mesosulfuron is absorbed through the foliage and roots of targeted species, providing systemic action that ensures effective control. Its usage is governed by stringent regulations to minimize environmental impact and to manage herbicide resistance through integrated weed management strategies.</p>Formula:C16H19N5O9S2Purity:Min. 95%Molecular weight:489.5 g/mol



