CAS 400858-54-0

1-ethyl-1H-pyrazole-4-carboxylic acid

Description:

1-Ethyl-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group attached to one nitrogen atom and a carboxylic acid functional group (-COOH) at the 4-position of the pyrazole ring. The presence of the carboxylic acid group imparts acidic properties, making it capable of donating protons in solution. The compound is typically a white to off-white solid and is soluble in polar solvents due to the hydrophilic nature of the carboxylic acid group. It may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structure allows for potential interactions with various biological targets, which could be explored for applications in medicinal chemistry. As with many pyrazole derivatives, it may also participate in various chemical reactions, including esterification and amidation, due to the reactivity of the carboxylic acid moiety.

Formula: C₆H₈N₂O₂

InChI: InChI=1/C6H8N2O2/c1-2-8-4-5(3-7-8)6(9)10/h3-4H,2H2,1H3,(H,9,10)

SMILES: CCn1cc(cn1)C(=O)O

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-ethyl-
• 1-Ethyl-1H-pyrazole-4-carboxylic acid

1-Ethyl-1H-pyrazole-4-carboxylic acid

CAS: 400858-54-0

Formula: C₆H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA003EBI

1-Ethyl-1H-pyrazole-4-carboxylic acid

CAS: 400858-54-0

1-Ethyl-1H-pyrazole-4-carboxylic acid

Purity: 97%

Molecular weight: 140.14g/mol

Ref: 54-OR306186

1-Ethyl-1H-pyrazole-4-carboxylic acid

CAS: 400858-54-0

Formula: C₆H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.142

Ref: 10-F028250