CAS 400877-26-1
:1-(3-chlorophenyl)pyrazole-4-carbaldehyde
Description:
1-(3-Chlorophenyl)pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the meta position relative to the pyrazole moiety. The aldehyde functional group (-CHO) is located at the 4-position of the pyrazole ring, contributing to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and material science. The presence of the chlorophenyl group may also influence its biological activity, potentially making it a candidate for further pharmacological studies. As with many organic compounds, handling should be done with care, considering safety protocols to mitigate any risks associated with its chemical properties.
Formula:C10H7ClN2O
InChI:InChI=1/C10H7ClN2O/c11-9-2-1-3-10(4-9)13-6-8(7-14)5-12-13/h1-7H
SMILES:c1cc(cc(c1)n1cc(cn1)C=O)Cl
Synonyms:- 1-(3-chlorophenyl)-1H-pyrazole-4-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(3-Chlorophenyl)-1H-pyrazole-4-carbaldehyde
CAS:1-(3-Chlorophenyl)-1H-pyrazole-4-carbaldehydePurity:95%Molecular weight:206.63g/mol1-(3-Chlorophenyl)-1H-pyrazole-4-carbaldehyde
CAS:1-(3-Chlorophenyl)-1H-pyrazole-4-carbaldehyde is a pesticide that acts as a selective insecticide. It is effective against the larval stage of insects, such as the cabbage moth, Plutella xylostella. This compound has been shown to have biological activity against mites and insects with hydrazine hydrochloride and cinnabarinus. 1-(3-Chlorophenyl)-1H-pyrazole-4-carbaldehyde has also been shown to be able to cyclize with hydrazine to form an insecticidal compound.
Formula:C10H7ClN2OPurity:Min. 95%Molecular weight:206.63 g/mol


