CAS 400878-04-8

3-[(2,3-Dichlorophenoxy)methyl]-4-methoxybenzaldehyde

Description:

3-[(2,3-Dichlorophenoxy)methyl]-4-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group, a methoxy group, and a dichlorophenoxy moiety. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as oxidation and condensation. The dichlorophenoxy group contributes to the compound's potential biological activity, as chlorinated aromatic compounds often exhibit herbicidal or pesticidal properties. The methoxy group can influence the compound's solubility and reactivity, making it more lipophilic. This compound may be of interest in medicinal chemistry and agrochemical applications due to its structural features. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and aromatic electrophilic substitution. Safety and handling precautions are essential when working with this compound, as it may possess toxicological risks associated with chlorinated compounds. Overall, 3-[(2,3-Dichlorophenoxy)methyl]-4-methoxybenzaldehyde represents a unique chemical entity with potential applications in various fields.

Formula: C₁₅H₁₂Cl₂O₃

InChI: InChI=1S/C15H12Cl2O3/c1-19-13-6-5-10(8-18)7-11(13)9-20-14-4-2-3-12(16)15(14)17/h2-8H,9H2,1H3

InChI key: InChIKey=SGPOXLKIXWBPOS-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C(Cl)=CC=C1)C2=C(OC)C=CC(C=O)=C2

Synonyms:

• 3-[(2,3-Dichlorophenoxy)methyl]-4-methoxybenzaldehyde
• Benzaldehyde, 3-[(2,3-dichlorophenoxy)methyl]-4-methoxy-