CAS 400878-19-5

Ethanone, 1-[4-(3-fluoropropoxy)phenyl]-

Description:

Ethanone, 1-[4-(3-fluoropropoxy)phenyl]- is an organic compound characterized by its ketone functional group and a phenyl ring substituted with a propoxy group that contains a fluorine atom. This compound features a molecular structure that includes a carbonyl group (C=O) attached to an ethyl group and a para-substituted phenyl ring, which contributes to its chemical reactivity and potential applications. The presence of the fluoropropoxy substituent enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and drug design. The compound is likely to exhibit moderate volatility and solubility in organic solvents, while its stability can be affected by environmental conditions such as temperature and light. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound's unique structure and properties make it a subject of interest in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₃FO₂

InChI: InChI=1S/C11H13FO2/c1-9(13)10-3-5-11(6-4-10)14-8-2-7-12/h3-6H,2,7-8H2,1H3

InChI key: InChIKey=MXMOMEDHZLHMBX-UHFFFAOYSA-N

SMILES: O(CCCF)C1=CC=C(C(C)=O)C=C1

Synonyms:

• Ethanone, 1-[4-(3-fluoropropoxy)phenyl]-

4-(3-Fluoropropoxy)acetophenone

CAS: 400878-19-5

4-(3-Fluoropropoxy)acetophenone

Formula: C₁₁H₁₃FO₂

Purity: By hplc: 96% (Typical Value in Batch COA)

Color and Shape: Liquid

Molecular weight: 196.22g/mol

Ref: 54-PC10208