CAS 40104-33-4
:5-bromothiophene-2-carbaldehyde thiosemicarbazone
Description:
5-Bromothiophene-2-carbaldehyde thiosemicarbazone is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with a bromine atom and an aldehyde functional group. The thiosemicarbazone moiety contributes to its reactivity and potential biological activity, as thiosemicarbazones are known for their ability to form coordination complexes with metal ions and exhibit various pharmacological properties. This compound typically appears as a solid and may exhibit moderate solubility in organic solvents. Its synthesis often involves the reaction of 5-bromothiophene-2-carbaldehyde with thiosemicarbazide, leading to the formation of the thiosemicarbazone linkage. The presence of the bromine atom can influence the compound's electronic properties and reactivity, making it a subject of interest in medicinal chemistry and materials science. Additionally, compounds of this type may exhibit antimicrobial, antifungal, or anticancer activities, making them valuable in drug development and research. As with many thiosemicarbazones, the compound's properties can be further explored through various analytical techniques.
Formula:C6H6BrN3S2
InChI:InChI=1/C6H6BrN3S2/c7-5-2-1-4(12-5)3-9-10-6(8)11/h1-3H,(H3,8,10,11)/b9-3+
Synonyms:- (2E)-2-[(5-Bromo-2-thienyl)methylene]hydrazinecarbothioamide
- hydrazinecarbothioamide, 2-[(5-bromo-2-thienyl)methylene]-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.