CAS 40106-58-9
:4-chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
Description:
4-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both sulfur and nitrogen atoms. The presence of a chlorine substituent at the 4-position contributes to its reactivity and potential biological activity. This compound features a fused thieno and pyrimidine ring system, which is significant in medicinal chemistry due to its potential pharmacological properties. The tetrahydro configuration indicates that the compound is saturated in certain positions, which can influence its solubility and stability. Typically, such compounds may exhibit a range of biological activities, including antimicrobial or anticancer properties, making them of interest in drug development. The molecular structure allows for various interactions with biological targets, and its unique characteristics may lead to specific applications in pharmaceuticals. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its reactivity and potential uses in various chemical and biological contexts.
Formula:C11H11ClN2S
InChI:InChI=1/C11H11ClN2S/c12-10-9-7-4-2-1-3-5-8(7)15-11(9)14-6-13-10/h6H,1-5H2
SMILES:C1CCc2c(CC1)sc1c2c(Cl)ncn1
Synonyms:- 5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine, 4-chloro-6,7,8,9-tetrahydro-
- 4-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
- 3-Chloro-8-thia-4,6- diazatricyclo[7.5.0.0{2,7}]tetradeca- 1(9),2(7),3,5-tetraene
- AKOS 92589
- BUTTPARK 99\57-80
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta-4,5-thieno[2,3-d]pyrimidine, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H11ClN2SPurity:96%Color and Shape:Yellow, PowderMolecular weight:238.734-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
CAS:Formula:C11H11ClN2SPurity:96%Color and Shape:SolidMolecular weight:238.73644-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
CAS:4-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidinePurity:95%Molecular weight:238.74g/mol4-Chloro-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
CAS:Purity:97.0%Molecular weight:238.72999572753906



