
CAS 40106-59-0
:4-Hydrazinyl-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
Description:
4-Hydrazinyl-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine, with CAS number 40106-59-0, is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thieno and pyrimidine moieties. This compound features a hydrazine functional group, which contributes to its reactivity and potential biological activity. The presence of multiple rings in its structure suggests that it may exhibit interesting conformational properties and interactions with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential antitumor or antimicrobial activities. The tetrahydro configuration indicates that the compound is saturated, which may influence its solubility and stability. Additionally, the presence of nitrogen atoms in the hydrazine and pyrimidine components may enhance its ability to form hydrogen bonds, potentially affecting its interactions in biological systems. Overall, this compound represents a class of organic molecules that could be of interest in medicinal chemistry and drug development.
Formula:C11H14N4S
InChI:InChI=1S/C11H14N4S/c12-15-10-9-7-4-2-1-3-5-8(7)16-11(9)14-6-13-10/h6H,1-5,12H2,(H,13,14,15)
InChI key:InChIKey=LZEOQQZABRMORS-UHFFFAOYSA-N
SMILES:N(N)=C1C=2C3=C(SC2NC=N1)CCCCC3
Synonyms:- 5H-Cyclohepta[4,5]thieno[2,3-d]pyrimidine, 4-hydrazinyl-6,7,8,9-tetrahydro-
- (6,7,8,9-Tetrahydro-5H-10-thia-1,3-diaza-benzo[a]azulen-4-yl)-hydrazine
- 4H-Cyclohepta[4,5]thieno[2,3-d]pyrimidin-4-one, 1,5,6,7,8,9-hexahydro-, hydrazone
- 4-Hydrazinyl-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.