CAS 40107-07-1

4-Chloro-6-iodoquinoline

Description:

4-Chloro-6-iodoquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of chlorine and iodine substituents at the 4 and 6 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The halogen substituents can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, 4-Chloro-6-iodoquinoline may exhibit antimicrobial or antitumor properties, making it of interest in drug discovery. Its synthesis often involves halogenation reactions and can be achieved through various methods, including electrophilic aromatic substitution. As with many halogenated compounds, it is essential to handle 4-Chloro-6-iodoquinoline with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.

Formula: C₉H₅ClIN

InChI: InChI=1/C9H5ClIN/c10-8-3-4-12-9-2-1-6(11)5-7(8)9/h1-5H

SMILES: c1cc2c(cc1I)c(ccn2)Cl

Synonyms:

• Quinoline, 4-Chloro-6-Iodo-
• 4-CHLORO-6-IODOQUINOLINE
• BUTTPARK 89\01-03

4-Chloro-6-iodoquinoline

CAS: 40107-07-1

Formula: C₉H₅ClIN

Purity: 97%

Color and Shape: Solid

Molecular weight: 289.5002

Ref: IN-DA00BYHZ

4-Chloro-6-iodoquinoline

CAS: 40107-07-1

4-Chloro-6-iodoquinoline

Purity: 97%

Molecular weight: 289.50g/mol

Ref: 54-OR94279

4-Chloro-6-iodoquinoline

CAS: 40107-07-1

Formula: C₉H₅ClIN

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 289.5

Ref: 10-F227886