CAS 40107-95-7

1,2-Dihydro-3H-pyrrolo[3,4-c]pyridin-3-one

Description:

1,2-Dihydro-3H-pyrrolo[3,4-c]pyridin-3-one, with the CAS number 40107-95-7, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound typically exhibits a bicyclic structure, which contributes to its unique chemical properties. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carbonyl group in the structure enhances its reactivity, allowing for various chemical transformations. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as temperature and pH. As a member of the pyrrolidine family, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, 1,2-Dihydro-3H-pyrrolo[3,4-c]pyridin-3-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c10-7-6-4-8-2-1-5(6)3-9-7/h1-2,4H,3H2,(H,9,10)

InChI key: InChIKey=ROSODFDWJFAKQI-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC=NC2)CN1

Synonyms:

• 1,2-Dihydro-3H-pyrrolo[3,4-c]pyridin-3-one
• 1,2-Dihydropyrrolo[3,4-c]pyridin-3-one
• 1H,2H,3H-pyrrolo[3,4-c]pyridin-3-one
• 2,3-Dihydro-1H-pyrrolo[3,4-c]pyridin-3-one
• 3H-Pyrrolo[3,4-c]pyridin-3-one, 1,2-dihydro-
• 4-(Aminomethyl)nicotinic acid lactam

1H,2H-pyrrolo[3,4-c]pyridin-3-one

CAS: 40107-95-7

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA007578

1H-Pyrrolo[3,4-c]pyridin-3(2H)-one

CAS: 40107-95-7

1H-Pyrrolo[3,4-c]pyridin-3(2H)-one

Purity: 97%

Molecular weight: 134.14g/mol

Ref: 54-OR74627

1H-Pyrrolo[3,4-c]pyridin-3(2H)-one

CAS: 40107-95-7

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.138

Ref: 10-F440517

1H,2H,3H-pyrrolo[3,4-c]pyridin-3-one

CAS: 40107-95-7

1H,2H,3H-pyrrolo[3,4-c]pyridin-3-one is a phosphoinositide synthesis inhibitor. It is an important drug target for the treatment of cancer due to its ability to inhibit the production of phosphoinositides that are necessary for the regulation of cell growth, proliferation and differentiation. The therapeutic potential of 1H,2H,3H-pyrrolo[3,4-c]pyridin-3-one has been demonstrated through chemistry studies and medicinal chemistry approaches. This molecule was synthesized with a 3-kinase inhibitor moiety and a reactive carboxamides group.

Formula: C₇H₆N₂O

Purity: Min. 95%

Molecular weight: 134.14 g/mol

Ref: 3D-QBA10795