CAS 4011-48-7
:3-hydroxy-1-methylestra-1,3,5(10)-trien-17-one
Description:
3-Hydroxy-1-methylestra-1,3,5(10)-trien-17-one, commonly known as a synthetic steroid, is characterized by its structural features that include a hydroxyl group at the 3-position and a methyl group at the 1-position of the estrane backbone. This compound belongs to the class of androgens and anabolic steroids, which are known for their ability to promote muscle growth and enhance physical performance. The presence of the double bonds in the steroid nucleus contributes to its biological activity and stability. Its molecular structure allows for interactions with androgen receptors, influencing various physiological processes. The compound is often studied for its potential applications in medicine, particularly in hormone replacement therapies and treatments for certain medical conditions. However, it is also associated with various side effects and regulatory scrutiny due to its anabolic properties. As with many synthetic steroids, its use is subject to legal restrictions in many countries, particularly in sports and bodybuilding contexts.
Formula:C19H24O2
InChI:InChI=1/C19H24O2/c1-11-9-13(20)10-12-3-4-14-15(18(11)12)7-8-19(2)16(14)5-6-17(19)21/h9-10,14-16,20H,3-8H2,1-2H3
SMILES:Cc1cc(cc2CCC3C(CCC4(C)C3CCC4=O)c12)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Methylestrone
CAS:Controlled Product1-Methylestrone is a chemical compound with the molecular formula C14H18O2. It is an estrogenic metabolite of estradiol, and is formed from the metabolism of estradiol by CYP1A2 and other cytochrome P450 enzymes. 1-Methylestrone has been shown to be an activator of certain estrogen receptors, such as ERα and ERβ, in breast cancer cells. 1-Methylestrone also has been shown to inhibit the production of cyclic AMP by phosphodiesterase 4B (PDE4B) in prostate cancer cells, which may be due to its ability to inhibit protein interactions.Formula:C19H24O2Purity:Min. 95%Molecular weight:284.4 g/mol



