CymitQuimica logo

CAS 40117-63-3

:

1-Azabicyclo[2.2.2]octane-4-carboxylic acid, hydrochloride

Description:
1-Azabicyclo[2.2.2]octane-4-carboxylic acid, hydrochloride, is a bicyclic compound characterized by its unique azabicyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile molecule in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is usually more soluble in water compared to its free base form, enhancing its utility in biological applications. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can influence its reactivity and interaction with biological targets. This compound may be of interest in the development of pharmaceuticals, particularly in the context of neurochemistry, due to its structural similarity to certain neurotransmitters. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and therapeutic settings.
Formula:C8H13NO2ClH
InChI:InChI=1S/C8H13NO2.ClH/c10-7(11)8-1-4-9(5-2-8)6-3-8;/h1-6H2,(H,10,11);1H
InChI key:JTYXRFSULOZNPH-UHFFFAOYSA-N
SMILES:C1CN2CCC1(CC2)C(=O)O.Cl
Synonyms:
  • 1-azabicyclo[2.2.2]octane-4-carboxylic acid hydrochloride
Found 7 products.