CymitQuimica logo

CAS 40122-38-1

:

1-Propylcyclopropanol

Description:
1-Propylcyclopropanol is an organic compound characterized by its unique structure, which features a cyclopropane ring bonded to a propyl group and a hydroxyl (-OH) functional group. This compound belongs to the class of alcohols and is notable for its three-membered cyclopropane ring, which imparts distinctive strain and reactivity compared to larger cyclic structures. The presence of the hydroxyl group makes it polar, enhancing its solubility in polar solvents and influencing its reactivity in various chemical reactions, such as dehydration and oxidation. 1-Propylcyclopropanol can participate in hydrogen bonding, which affects its boiling point and other physical properties. Its synthesis typically involves the functionalization of cyclopropane derivatives or the use of specific catalytic methods. The compound's applications may extend to organic synthesis, where it can serve as an intermediate or a building block for more complex molecules. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-2-3-6(7)4-5-6/h7H,2-5H2,1H3
InChI key:InChIKey=PEECWTGZUDNPNQ-UHFFFAOYSA-N
SMILES:C(CC)C1(O)CC1
Synonyms:
  • 1-Propylcyclopropanol
  • 1-Propyl-1-cyclopropanol
  • Cyclopropanol, 1-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.