CAS 40133-06-0
:5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid
Description:
5,6-Dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique bicyclic structure, which incorporates both a thiophene ring and a cyclopentane moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The presence of the thiophene ring imparts aromatic characteristics, while the saturated cyclopentane component adds to the compound's stability and influences its physical properties. Typically, compounds of this nature may exhibit moderate solubility in polar solvents due to the carboxylic acid group, while their overall hydrophobic character may lead to limited solubility in non-polar solvents. The compound may also participate in hydrogen bonding due to the carboxylic acid, affecting its interactions in biological systems or materials science applications. Its unique structure makes it of interest in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C8H8O2S
InChI:InChI=1/C8H8O2S/c9-8(10)7-4-5-2-1-3-6(5)11-7/h4H,1-3H2,(H,9,10)
SMILES:C1Cc2cc(C(=O)O)sc2C1
Synonyms:- 4H-Cyclopenta[b]thiophene-2-carboxylic acid, 5,6-dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5,6-Dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid
CAS:Formula:C8H8O2SPurity:98%Color and Shape:SolidMolecular weight:168.21295,6-Dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid
CAS:5,6-Dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acidFormula:C8H8O2SPurity:≥95%Color and Shape:SolidMolecular weight:168.21g/mol5,6-Dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid
CAS:Formula:C8H8O2SPurity:97%Color and Shape:SolidMolecular weight:168.21PRL3-CNNM4 interaction-IN-1
CAS:PRL3-CNNM4 interaction-IN-1 (Compound C28d52) is an inhibitor of the PRL3-CNNM4 interaction that also suppresses CNNM inhibition mediated by PRL. This compound exhibits favorable pharmacokinetic and drug metabolism properties.Formula:C8H8O2SColor and Shape:SolidMolecular weight:168.21



