CAS 40133-22-0

2-(4-bromophenyl)thiophene

Description:

2-(4-bromophenyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromophenyl group at the second position of the thiophene ring enhances its electronic properties, making it useful in various applications, including organic electronics and materials science. This compound typically exhibits good thermal stability and can participate in various chemical reactions, such as electrophilic substitutions due to the electron-rich nature of the thiophene ring. Its molecular structure contributes to its potential as a building block in the synthesis of more complex organic molecules. Additionally, the bromine substituent can facilitate further functionalization, allowing for the development of derivatives with tailored properties. The compound is generally soluble in organic solvents, which is advantageous for its use in solution-based processes. Overall, 2-(4-bromophenyl)thiophene is of interest in research and industrial applications due to its unique structural features and reactivity.

Formula: C₁₀H₇BrS

InChI: InChI=1/C10H7BrS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H

SMILES: c1cc(c2ccc(cc2)Br)sc1

2-(4-Bromophenyl)thiophene

CAS: 40133-22-0

Formula: C₁₀H₇BrS

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.1316

Ref: IN-DA003EVE

2-(4-Bromophenyl)thiophene

CAS: 40133-22-0

2-(4-Bromophenyl)thiophene

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.13158g/mol

Ref: 54-OR1416

2-(4-Bromophenyl)thiophene

CAS: 40133-22-0

Formula: C₁₀H₇BrS

Purity: >97.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 239.13

Ref: 3B-B5106

2-(4-Bromophenyl)thiophene

CAS: 40133-22-0

Formula: C₁₀H₇BrS

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.13

Ref: 10-F221695

2-(4-Bromophenyl)thiophene

Controlled Product

CAS: 40133-22-0

Formula: C₁₀H₇BrS

Color and Shape: Neat

Molecular weight: 239.13

Ref: TR-B687735