CAS 40133-23-1
:2-(4-Chlorophenyl)thiophene
Description:
2-(4-Chlorophenyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a 4-chlorophenyl group at the second position of the thiophene ring enhances its chemical reactivity and influences its physical properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water due to its hydrophobic nature. It is known for its potential applications in organic electronics, particularly in the development of organic semiconductors and photovoltaic materials. The chlorophenyl substituent can also impart specific electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting photophysical properties, which can be leveraged in dye-sensitized solar cells or as a fluorescent probe in biochemical applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H7ClS
InChI:InChI=1S/C10H7ClS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H
InChI key:InChIKey=QJEWBNFDFWXRLR-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=C1)C2=CC=CS2
Synonyms:- 2-(4-Chloro-Phenyl)-Thiophene
- 2-(p-Chlorophenyl)thiophene
- Thiophene, 2-(4-chlorophenyl)-
- Thiophene, 2-(p-chlorophenyl)-
- 2-(4-Chlorophenyl)thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.