CAS 40137-24-4

2,2-Dimethyl-1,3-dioxan-5-amine

Description:

2,2-Dimethyl-1,3-dioxan-5-amine is an organic compound characterized by its unique dioxane ring structure, which features two methyl groups attached to the carbon adjacent to the nitrogen-containing amine group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits moderate solubility in water and is more soluble in organic solvents, making it versatile for various applications in organic synthesis and chemical research. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. Additionally, the dioxane ring contributes to its stability and potential use as a solvent or reagent in chemical reactions. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, 2,2-Dimethyl-1,3-dioxan-5-amine is a compound of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₆H₁₃NO₂

InChI: InChI=1S/C6H13NO2/c1-6(2)8-3-5(7)4-9-6/h5H,3-4,7H2,1-2H3

InChI key: InChIKey=ADLFBRNPQMLXTQ-UHFFFAOYSA-N

SMILES: CC1(C)OCC(N)CO1

Synonyms:

• 5-Amino-2,2-dimethyl-1,3-dioxan
• 2,2-Dimethyl-1,3-dioxan-5-amine
• 5-Amino-2,2-dimethyl-1,3-dioxane
• 1,3-Dioxan-5-amine, 2,2-dimethyl-

2,2-Dimethyl-1,3-dioxan-5-amine

CAS: 40137-24-4

Formula: C₆H₁₃NO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 131.1729

Ref: IN-DA00C6Y7

2,2-Dimethyl-1,3-dioxan-5-amine

CAS: 40137-24-4

2,2-Dimethyl-1,3-dioxan-5-amine

Purity: 96%

Molecular weight: 131.17g/mol

Ref: 54-OR94049

(2,2-dimethyl-1,3-dioxan-5-yl)amine

CAS: 40137-24-4

Formula: C₆H₁₃NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 131.175

Ref: 10-F360819

2,2-Dimethyl-1,3-dioxan-5-amine

CAS: 40137-24-4

2,2-Dimethyl-1,3-dioxan-5-amine is an organic molecule that utilizes electron affinity to synthesize with a variety of orientations. The hydrophobic and intramolecular orientations are the most common. The 2,2-dimethyl-1,3-dioxan-5-amine molecule has been shown to be capable of utilizing the hydrogen atom in water as an electron acceptor and donor. It can also form a monolayer on a gold electrode surface. This molecule is hydrophilic and therefore prefers hydrophilic environments such as the electrode surface or water. Impurities in this compound may include fluoride ion or chloride ion.

Formula: C₆H₁₃NO₂

Purity: Min. 95%

Molecular weight: 131.18 g/mol

Ref: 3D-QBA13724