CAS 40143-27-9

P-phenylbenzaldoxime

Description:

P-phenylbenzaldoxime, with the CAS number 40143-27-9, is an organic compound characterized by its oxime functional group attached to a phenyl ring and a benzaldehyde moiety. This compound typically appears as a solid and is known for its ability to form coordination complexes with various metal ions, making it useful in analytical chemistry and metal ion extraction processes. P-phenylbenzaldoxime exhibits moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structure. The compound is often utilized in the synthesis of other organic compounds and may also serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the oxime group, which can participate in various chemical reactions, including condensation and rearrangement. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₁₃H₁₁NO

InChI: InChI=1/C13H11NO/c15-14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10,15H/b14-10-

SMILES: c1ccc(cc1)c1ccc(cc1)/C=N\O

[1,1'-Biphenyl]-4-carbaldehyde oxime

CAS: 40143-27-9

Formula: C₁₃H₁₁NO

Molecular weight: 197.2325

Ref: IN-DA00BXY8

4-Biphenylaldehyde oxime

CAS: 40143-27-9

4-Biphenylaldehyde oxime

Purity: 95%

Molecular weight: 197.23g/mol

Ref: 54-OR945368

4-Phenylbenzaldehyde oxime

CAS: 40143-27-9

4-Phenylbenzaldehyde oxime is a high quality reagent that is used as a building block in the synthesis of complex compounds. It is an aromatic compound with a chemical formula of C8H7O2N. This product can be used to make a variety of useful intermediates, fine chemicals, and speciality chemicals. 4-Phenylbenzaldehyde oxime has been identified as a potentially useful scaffold for synthetic organic chemistry and research into new drugs. It is also used as an intermediate in the production of other organic compounds. This product has been shown to be versatile and can be used to synthesize many different types of reactions.

Formula: C₁₃H₁₁NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 197.23 g/mol

Ref: 3D-FP70129

(E)-[1,1′-biphenyl]-4-carbaldehyde oxime

CAS: 40143-27-9

Purity: 98%

Molecular weight: 197.2369995

Ref: 10-F773684