CAS 40143-27-9: P-phenylbenzaldoxime
Description:P-phenylbenzaldoxime, with the CAS number 40143-27-9, is an organic compound characterized by its oxime functional group attached to a phenyl ring and a benzaldehyde moiety. This compound typically appears as a solid and is known for its ability to form coordination complexes with various metal ions, making it useful in analytical chemistry and metal ion extraction processes. P-phenylbenzaldoxime exhibits moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structure. The compound is often utilized in the synthesis of other organic compounds and may also serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the oxime group, which can participate in various chemical reactions, including condensation and rearrangement. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c15-14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10,15H/b14-10-

Ref: 10-F773684
1g | To inquire | ||
5g | To inquire |

4-Phenylbenzaldehyde oxime
Ref: 3D-FP70129
5g | 184.00 € | ||
10g | 287.00 € | ||
25g | 470.00 € |