CAS 40144-12-5
:se-(P-nitrobenzyl)-6-selenoinosine
Description:
Se-(P-nitrobenzyl)-6-selenoinosine is a chemical compound that belongs to the class of seleno-nucleosides, which are derivatives of nucleosides containing selenium. This compound features a seleno atom in its structure, which can impart unique biochemical properties, particularly in terms of its reactivity and potential biological activity. The presence of the nitrobenzyl group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological profile. Seleno-nucleosides are of interest in medicinal chemistry due to their potential roles in antiviral and anticancer therapies, as selenium is known for its antioxidant properties and ability to modulate cellular processes. The compound's structure may also affect its solubility, stability, and interaction with nucleic acids. As with many seleno-compounds, careful consideration of its handling and toxicity is essential, given the unique properties of selenium in biological systems. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.
Formula:C17H17N5O6Se
InChI:InChI=1/C17H17N5O6Se/c23-5-11-13(24)14(25)17(28-11)21-8-20-12-15(21)18-7-19-16(12)29-6-9-1-3-10(4-2-9)22(26)27/h1-4,7-8,11,13-14,17,23-25H,5-6H2
SMILES:c1cc(ccc1C[Se]c1c2c(ncn1)n(cn2)C1C(C(C(CO)O1)O)O)N(=O)=O
Synonyms:- 6-[(4-nitrobenzyl)selanyl]-9-pentofuranosyl-9H-purine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4'-Nitrobenzoyl-6-selenoinosine
CAS:4'-Nitrobenzoyl-6-selenoinosine is a monophosphate nucleoside that is synthesized by the phosphoramidite method. It has been shown to have antiviral and anticancer activities. The compound inhibits the synthesis of DNA and RNA, which may be due to its ability to inhibit the enzyme ribonucleotide reductase. 4'-Nitrobenzoyl-6-selenoinosine has also been shown to activate cellular transcription factors such as NF-κB and AP-1, resulting in increased expression of genes involved in apoptosis.Formula:C17H15N5O7SePurity:Min. 95%Molecular weight:480.29 g/mol

