CAS 40155-43-9
:5-Aminopyrazine-2-carboxylic Acid
Description:
5-Aminopyrazine-2-carboxylic acid is an organic compound characterized by its pyrazine ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically represented by the molecular formula C5H6N4O2, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. It is a crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical applications. The amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as amide formation and esterification. 5-Aminopyrazine-2-carboxylic acid is of interest in pharmaceutical research and development due to its potential biological activity, including antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex molecules in medicinal chemistry. Proper handling and storage are essential, as with many chemical substances, to ensure safety and stability.
Formula:C5H5N3O2
InChI:InChI=1/C5H5N3O2/c6-4-2-7-3(1-8-4)5(9)10/h1-2H,(H2,6,8)(H,9,10)
SMILES:c1c(C(=O)O)ncc(N)n1
Synonyms:- 5-Amino-2-Pyrazinecarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Aminopyrazine-2-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H5N3O2Purity:95%Molecular weight:139.115-Aminopyrazine-2-carboxylic acid
CAS:Formula:C5H5N3O2Purity:95%Color and Shape:SolidMolecular weight:139.11215-Aminopyrazine-2-carboxylic acid
CAS:5-Aminopyrazine-2-carboxylic acidPurity:98%Molecular weight:139.11g/mol2-Amino-5-pyrazinecarboxylic acid
CAS:Formula:C5H5N3O2Purity:97%Color and Shape:SolidMolecular weight:139.114



