CAS 401567-43-9

5-bromo-3-chloro-1,2-benzoxazole

Description:

5-Bromo-3-chloro-1,2-benzoxazole is a heterocyclic organic compound characterized by its fused benzene and oxazole rings, which contribute to its aromatic properties. The presence of bromine and chlorine substituents at the 5 and 3 positions, respectively, enhances its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic system. It may display biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability under standard conditions is generally good, although it may be sensitive to strong acids or bases. Its unique combination of halogen substituents and the benzoxazole framework makes it a valuable intermediate in organic synthesis and a candidate for further study in the development of new materials or drugs.

Formula: C₇H₃BrClNO

InChI: InChI=1/C7H3BrClNO/c8-4-1-2-6-5(3-4)7(9)10-11-6/h1-3H

SMILES: c1cc2c(cc1Br)c(Cl)no2

Synonyms:

• 1,2-Benzisoxazole, 5-Bromo-3-Chloro-
• 5-Bromo-3-chloro-1,2-benzoxazole

5-BROMO-3-CHLOROBENZO[D]ISOXAZOLE

CAS: 401567-43-9

Formula: C₇H₃BrClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.4618

Ref: IN-DA00CLMG

5-Bromo-3-chlorobenzo[d]isoxazole

CAS: 401567-43-9

5-Bromo-3-chlorobenzo[d]isoxazole

Purity: 99%

Molecular weight: 232.46g/mol

Ref: 54-OR82269

5-Bromo-3-chlorobenzo[d]isoxazole

CAS: 401567-43-9

Purity: 97%

Molecular weight: 232.4600067

Ref: 10-F603075

5-bromo-3-chloro-1,2-benzoxazole

CAS: 401567-43-9

Versatile small molecule scaffold

Formula: C₇H₃BrClNO

Purity: Min. 95%

Molecular weight: 232.5 g/mol

Ref: 3D-BRA56743