CymitQuimica logo

CAS 401567-85-9

:

4-Chloro-8-fluoro-2-(trifluoromethyl)quinoline

Description:
4-Chloro-8-fluoro-2-(trifluoromethyl)quinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a chloro group at the 4-position, a fluoro group at the 8-position, and a trifluoromethyl group at the 2-position, contributing to its unique chemical properties. The presence of multiple halogen substituents enhances its lipophilicity and may influence its reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethyl group is known for imparting significant electronic effects, which can affect the compound's reactivity in various chemical reactions. Additionally, compounds of this type may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential biological activity. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C10H4ClF4N
InChI:InChI=1/C10H4ClF4N/c11-6-4-8(10(13,14)15)16-9-5(6)2-1-3-7(9)12/h1-4H
InChI key:CFSUQVZKCFPECU-UHFFFAOYSA-N
SMILES:c1cc2c(cc(C(F)(F)F)nc2c(c1)F)Cl
Synonyms:
  • Quinoline, 4-chloro-8-fluoro-2-(trifluoromethyl)-
Found 4 products.