CAS 40165-88-6

Undecanoicacid, 3-hydroxy-

Description:

Undecanoic acid, 3-hydroxy- is a fatty acid characterized by a long hydrocarbon chain and a hydroxyl functional group. It is a medium-chain fatty acid with a total of 11 carbon atoms in its structure, which contributes to its hydrophobic properties. The presence of the hydroxyl group (-OH) at the third carbon position introduces polar characteristics, making it more soluble in water compared to its non-hydroxylated counterparts. This compound is typically found in various natural sources and can be synthesized through chemical processes. It exhibits properties such as being a potential surfactant and emulsifier due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. Additionally, undecanoic acid, 3-hydroxy- may have applications in the production of esters, which are used in cosmetics, food, and pharmaceuticals. Its stability and reactivity can vary depending on environmental conditions, making it a subject of interest in both industrial and research settings.

Formula: C₁₁H₂₂O₃

InChI: InChI=1S/C11H22O3/c1-2-3-4-5-6-7-8-10(12)9-11(13)14/h10,12H,2-9H2,1H3,(H,13,14)

InChI key: FARPMBPKLYEDIL-UHFFFAOYSA-N

SMILES: CCCCCCCCC(CC(=O)O)O

Synonyms:

• 3-Hydroxyundecanoicacid
• b-Hydroxyundecanoic acid

3-Hydroxyundecanoic acid

CAS: 40165-88-6

3-Hydroxyundecanoic acid

Formula: C₁₁H₂₂O₃

Purity: 97%

Molecular weight: 202.29

Ref: 54-OR1054865

3-Hydroxyundecanoic acid

CAS: 40165-88-6

Formula: C11H22O3

Purity: >98%

Color and Shape: Solid

Molecular weight: 202.29

Ref: 48-14-1103

3-hydroxy Undecanoic Acid

CAS: 40165-88-6

3-hydroxy Undecanoic acid, found in S. algae, B. catarrhalis LPS, and P. flava PHA, inhibits giant squid axon sodium current with an ED50 of 0.46 mM.

Formula: C₁₁H₂₂O₃

Color and Shape: Solid

Molecular weight: 202.29

Ref: TM-T38207

3-Hydroxyundecanoic acid

CAS: 40165-88-6

Formula: C₁₁H₂₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.2906

Ref: IN-DA007513

3-Hydroxyundecanoic acid

CAS: 40165-88-6

3-Hydroxyundecanoic acid is a synthetic fatty acid that has been shown to have insecticidal properties. It can be synthesized in an efficient method, which involves the reaction of 3-hydroxyundecanal and acetic acid. 3-Hydroxyundecanoic acid has been shown to inhibit growth of gram-negative bacteria, such as Vibrio harveyi and Chromobacterium violaceum, and endophytic fungi such as Microsporum gypseum. The chemical structure of 3-hydroxyundecanoic acid is similar to that of fatty acids found in plants. This similarity may explain its inhibitory effect on plant physiology.

Formula: C₁₁H₂₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 202.29 g/mol

Ref: 3D-QBA16588

3-Hydroxyundecanoic acid

CAS: 40165-88-6

3-Hydroxyundecanoic acid

Formula: C₁₁H₂₂O₃

Purity: 97%

Molecular weight: 202.29

Ref: IN-DG87416

rac-3-Hydroxyundecanoic Acid

Controlled Product

CAS: 40165-88-6

Formula: C₁₁H₂₂O₃

Color and Shape: Neat

Molecular weight: 202.291

Ref: TR-H990750