CAS 40171-90-2

2-[[(2,5-Dimethoxyphenyl)methyl]amino]ethanol

Description:

2-[[(2,5-Dimethoxyphenyl)methyl]amino]ethanol, with the CAS number 40171-90-2, is an organic compound characterized by its structure, which includes a dimethoxy-substituted phenyl group attached to an aminoethanol moiety. This compound features a secondary amine, where the nitrogen atom is bonded to both the phenyl group and an ethanol group, contributing to its potential biological activity. The presence of methoxy groups enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. Additionally, the hydroxyl group in the ethanol part of the molecule can participate in hydrogen bonding, affecting its solubility and reactivity. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could relate to various therapeutic effects. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies. As with any chemical substance, proper handling and safety precautions should be observed, given the potential for varied effects based on its chemical nature.

Formula: C₁₁H₁₇NO₃

InChI: InChI=1S/C11H17NO3/c1-14-10-3-4-11(15-2)9(7-10)8-12-5-6-13/h3-4,7,12-13H,5-6,8H2,1-2H3

InChI key: InChIKey=JVWUNGHEVLANLA-UHFFFAOYSA-N

SMILES: C(NCCO)C1=C(OC)C=CC(OC)=C1

Synonyms:

• 2-[[(2,5-Dimethoxyphenyl)methyl]amino]ethanol
• 2-[[(2,5-Dimethoxyphenyl)methyl]amino]ethan-1-ol
• Ethanol, 2-[[(2,5-dimethoxyphenyl)methyl]amino]-

2-{[(2,5-Dimethoxyphenyl)methyl]amino}ethan-1-ol

CAS: 40171-90-2

Versatile small molecule scaffold

Formula: C₁₁H₁₇NO₃

Purity: Min. 95%

Molecular weight: 211.26 g/mol

Ref: 3D-QBA17190