CAS 40171-95-7

N-(3,4-dimethoxybenzyl)ethanamine

Description:

N-(3,4-dimethoxybenzyl)ethanamine is an organic compound characterized by its amine functional group and a substituted benzyl moiety. The presence of two methoxy groups on the benzene ring enhances its electron-donating properties, which can influence its reactivity and interaction with biological systems. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic structure, while its amine group can engage in hydrogen bonding, potentially increasing its solubility in polar solvents. The compound may also display basic properties due to the amine, allowing it to participate in various chemical reactions, such as alkylation or acylation. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit interesting biological activities. However, specific biological effects and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-4-12-8-9-5-6-10(13-2)11(7-9)14-3/h5-7,12H,4,8H2,1-3H3

SMILES: CCNCc1ccc(c(c1)OC)OC

N-(3,4-Dimethoxybenzyl)-n-ethylamine, HCl

CAS: 40171-95-7

Formula: C₁₁H₁₇NO₂

Molecular weight: 195.2582

Ref: IN-DA00CLQL

[(3,4-Dimethoxyphenyl)methyl](ethyl)amine

CAS: 40171-95-7

Versatile small molecule scaffold

Formula: C₁₁H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 231.72 g/mol

Ref: 3D-QBA17195