CAS 40171-98-0: (3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)methanaminium

Description:(3,4-Dimethoxyphenyl)-N-(furan-2-ylmethyl)methanaminium is a chemical compound characterized by its unique structure, which includes a dimethoxy-substituted phenyl group and a furan moiety linked through a methanaminium group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the furan ring, which is known for its reactivity and ability to participate in various chemical reactions. The dimethoxy groups can influence the compound's solubility and electronic properties, potentially enhancing its interaction with biological targets. Additionally, the methanaminium functional group may impart basic characteristics, allowing for protonation under certain conditions. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents, although specific biological activities and applications would require further investigation and empirical data.

Formula:C₁₄H₁₈NO₃

InChI:InChI=1/C14H17NO3/c1-16-13-6-5-11(8-14(13)17-2)9-15-10-12-4-3-7-18-12/h3-8,15H,9-10H2,1-2H3/p+1