CAS 40173-94-2
:2-(2-Bromoethyl)-1,3-dichlorobenzene
Description:
2-(2-Bromoethyl)-1,3-dichlorobenzene is an organic compound characterized by its aromatic structure, featuring a dichlorobenzene core with a bromoethyl substituent. The presence of two chlorine atoms on the benzene ring contributes to its reactivity and potential applications in various chemical processes. The bromoethyl group introduces a halogenated alkyl chain, which can participate in nucleophilic substitution reactions, making the compound useful in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is important to handle it with care due to its potential toxicity and environmental impact, as halogenated compounds can be hazardous. The compound's molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, influencing its solubility and reactivity in different solvents. As with many halogenated organic compounds, it may also exhibit biological activity, warranting further investigation into its safety and ecological effects.
Formula:C8H7BrCl2
InChI:InChI=1S/C8H7BrCl2/c9-5-4-6-7(10)2-1-3-8(6)11/h1-3H,4-5H2
InChI key:InChIKey=ZWMPYIRPUBVKPN-UHFFFAOYSA-N
SMILES:C(CBr)C1=C(Cl)C=CC=C1Cl
Synonyms:- Benzene, 2-(2-bromoethyl)-1,3-dichloro-
- 2,6-Dichlorophenethyl bromide
- 2-(2-Bromoethyl)-1,3-dichlorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Dichlorophenethyl bromide
CAS:<p>2,6-Dichlorophenethyl bromide is a heterocyclic compound that is an agonist of the farnesoid X receptor (FXR). It has been shown to be effective in treating metabolic diseases such as diabetes and obesity. 2,6-Dichlorophenethyl bromide has also been shown to reduce liver damage in experimental models of nonalcoholic steatohepatitis. This drug binds to FXR and activates the receptor, which then induces the production of bile acids. These bile acids are important for the digestion of fats and absorption of fat soluble vitamins. 2,6-Dichlorophenethyl bromide is metabolized by CYP3A4 enzyme and can cause drug interactions with other drugs that are metabolized by this enzyme.</p>Formula:C8H7BrCl2Purity:Min. 95%Molecular weight:253.95 g/mol


