CAS 40176-80-5

2-ethynyl-1,3-benzothiazole

Description:

2-Ethynyl-1,3-benzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole ring fused with an ethynyl group. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in various fields, including materials science and organic synthesis. It possesses a relatively high melting point and is soluble in organic solvents, making it suitable for use in formulations and reactions requiring non-polar environments. The presence of the ethynyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as cross-coupling and polymerization. Additionally, 2-ethynyl-1,3-benzothiazole may exhibit interesting photophysical properties, which can be harnessed in the development of fluorescent materials or sensors. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, its distinctive chemical structure and properties make it a compound of interest in both research and industrial applications.

Formula: C₉H₅NS

InChI: InChI=1/C9H5NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h1,3-6H

SMILES: C#Cc1nc2ccccc2s1

Synonyms:

• Benzothiazole, 2-Ethynyl-

2-Ethynylbenzothiazole

CAS: 40176-80-5

Formula: C₉H₅NS

Purity: >97.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 159.21

Ref: 3B-E1091

2-Ethynyl-1,3-benzothiazole

CAS: 40176-80-5

Formula: C₉H₅NS

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.2077

Ref: IN-DA00CAFQ

2-Ethynylbenzothiazole

CAS: 40176-80-5

2-Ethynylbenzothiazole

Purity: >97.0%

Ref: 54-OR1077468

2-Ethynyl-1,3-benzothiazole

CAS: 40176-80-5

Purity: 97%

Molecular weight: 159.2100067

Ref: 10-F649847

2-Ethynylbenzothiazole

CAS: 40176-80-5

2-Ethynylbenzothiazole is a synthetic chemical that can be used as a fluorescent probe. It has been shown to react with nucleophilic compounds, such as thiols and amines, in the presence of palladium complexes. The reaction is catalyzed by the addition of hydrogen chloride. 2-Ethynylbenzothiazole reacts with thiols and amines to form a new compound called 2-chlorobenzothiazole. This reaction also produces hydrogen gas and heat. When 2-ethynylbenzothiazole is combined with vitamin B1, it undergoes electrophilic attack by an electron-rich heterocycle, leading to the formation of an intermediate product that fluoresces brightly.

Formula: C₉H₅NS

Purity: Min. 95%

Molecular weight: 159.21 g/mol

Ref: 3D-QBA17680