CAS 401788-99-6: 1-Butyl-4-methylpyridinium hexafluorophosphate
Description:1-Butyl-4-methylpyridinium hexafluorophosphate is an ionic liquid characterized by its unique combination of a pyridinium cation and a hexafluorophosphate anion. The cation, 1-butyl-4-methylpyridinium, features a butyl group and a methyl group attached to the pyridine ring, contributing to its hydrophobic properties and enhancing its solubility in organic solvents. The hexafluorophosphate anion is known for its high stability and low volatility, making the compound suitable for various applications in electrochemistry and as a solvent in organic synthesis. This ionic liquid exhibits a low melting point, which allows it to remain in a liquid state at room temperature, and it is non-volatile, reducing the risk of evaporation during use. Additionally, it has good thermal stability and can dissolve a wide range of polar and non-polar compounds, making it valuable in fields such as catalysis, battery technology, and as an electrolyte in electrochemical devices. Its unique properties make it a subject of interest in both academic and industrial research.
Formula:C10H16N·F6P
InChI:InChI=1S/C10H16N.F6P/c1-3-4-7-11-8-5-10(2)6-9-11;1-7(2,3,4,5)6/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1
InChI key:InChIKey=XBSZSSGZQFAUPF-UHFFFAOYSA-N
SMILES:[F-][P+5]([F-])([F-])([F-])([F-])[F-].C=1C=[N+](C=CC1C)CCCC
- Synonyms:
- 1-Butyl-4-methylpyridinium Hexafluorophosphate
- N-Butyl-4-methylpyridinium hexafluorophosphate
- Pyridinium, 1-butyl-4-methyl-, hexafluorophosphate(1-)
- Pyridinium, 1-butyl-4-methyl-, hexafluorophosphate(1-) (1:1)
