CymitQuimica logo

CAS 401797-02-2

:

2-(3,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(3,4-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound contains a dichlorophenyl group, contributing to its potential reactivity and applications in organic synthesis, particularly in cross-coupling reactions. The presence of tetramethyl substituents enhances its stability and solubility in organic solvents. Typically, compounds like this are utilized in medicinal chemistry and materials science due to their ability to participate in various chemical transformations. The dioxaborolane moiety is known for its role in facilitating the formation of carbon-boron bonds, making it valuable in the synthesis of complex organic molecules. Additionally, the dichlorophenyl group may impart specific electronic properties, influencing the compound's reactivity and interaction with biological systems. Overall, this compound exemplifies the versatility of boron-containing compounds in synthetic chemistry.
Formula:C12H15BCl2O2
InChI:InChI=1/C12H15BCl2O2/c1-11(2)12(3,4)17-13(16-11)8-5-6-9(14)10(15)7-8/h5-7H,1-4H3
InChI key:DTAZBCNEXKOLPE-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(c(c2)Cl)Cl)O1
Found 5 products.