CAS 40183-35-5
:2-(benzylsulfanyl)-4-chlorobenzoic acid
Description:
2-(Benzylsulfanyl)-4-chlorobenzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a benzylsulfanyl group and a chlorine atom. The presence of the benzylsulfanyl group introduces a sulfur atom into the molecule, which can influence its reactivity and solubility. The chlorine atom, located at the para position relative to the carboxylic acid group, contributes to the compound's electronic properties, potentially enhancing its acidity and affecting its interactions with other molecules. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can facilitate its incorporation into various organic reactions or applications in medicinal chemistry. Additionally, the presence of both the carboxylic acid and the sulfanyl group may provide opportunities for further functionalization, making it a versatile intermediate in synthetic organic chemistry. Overall, 2-(benzylsulfanyl)-4-chlorobenzoic acid is a compound of interest for its potential applications in pharmaceuticals and materials science.
Formula:C14H11ClO2S
InChI:InChI=1/C14H11ClO2S/c15-11-6-7-12(14(16)17)13(8-11)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)
SMILES:c1ccc(cc1)CSc1cc(ccc1C(=O)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(Benzylthio)-4-chlorobenzoic Acid
CAS:Controlled ProductFormula:C14H11ClO2SColor and Shape:NeatMolecular weight:278.75

